PYQSide ExamsMy practice

Hydrocarbons · Question 33

AIPMT 2015 (Cancelled)MCQMedium📈 Topic in 62% papers+4−1
1

A single compound of the structure, [figure] is obtainable from ozonolysis of which of the following cyclic compounds?

  1. [figure]
  2. [figure]
  3. [figure]
  4. [figure]

Answer

(3) [figure]

Solution

Ozonolysis cleaves the C=C bond; each doubly bonded carbon becomes C=O. A ring C=C gives one open-chain dicarbonyl compound.

Required product: CH3- O \|C-CH2- CH3 |CH-CH2-CHO (one ketone C bearing CH3, one CHO, and a CH(CH3) between two CH2 groups).

(1) gives OHC-C(CH3)2-CH2-CH2-CHO (dialdehyde)

(2) gives CH3CO-CH2CH2CH2-COCH3 (diketone)

(3) the C=C carbon with CH3 becomes CH3C=O, the other C=C carbon becomes CHO, and the ring chain CH2-CH(CH3)-CH2 joins them ⇒ exactly the given compound

(4) gives OHC-CH(CH3)-CH(CH3)-CH2-CHO

Answer: (3)

AIPMT 2015 (Cancelled)

Keep practising — Hydrocarbons

2

The reaction of C6H5CH=CHCH3 with HBr produces

  1. C6H5CH2CH2CH2Br
  2. [figure]
  3. C6H5 Br |CHCH2CH3
  4. C6H5CH2 Br |CHCH3
AIPMT 2015 (Cancelled)
3

What products are formed when the following compound is treated with Br2 in the presence of FeBr3? [figure]

  1. [figure]
  2. [figure]
  3. [figure]
  4. [figure]
AIPMT 2014
4

Some meta-directing substituents in aromatic substitution are given. Which one is most deactivating ?

  1. -COOH
  2. -NO2
  3. -C N
  4. -SO3H
NEET 2013
5

Which of the following compounds will not undergo Friedel-Crafts reaction easily?

  1. Nitrobenzene
  2. Toluene
  3. Cumene
  4. Xylene
NEET 2013
6

Nitrobenzene on reaction with conc. HNO3/H2SO4 at 80-100 C forms which one of the following products?

  1. 1, 4-Dinitrobenzene
  2. 1, 2, 4 - Trinitrobenzene
  3. 1, 2-Dinitrobenzene
  4. 1, 3-Dinitrobenzene
NEET 2013
7

Which of the following reagents will be able to distinguish between 1-butyne and 2-butyne?

  1. NaNH2
  2. HCl
  3. O2
  4. Br2
AIPMT 2012 (Mains)
8

Among the following compounds the one that is most reactive towards electrophilic nitration is

  1. benzoic acid
  2. nitrobenzene
  3. toluene
  4. benzene
AIPMT 2012 (Prelims)
9

Liquid hydrocarbons can be converted to a mixture of gaseous hydrocarbons by

  1. oxidation
  2. cracking
  3. distillation under reduced pressure
  4. hydrolysis
AIPMT 2010 (Prelims)
10

Benzene reacts with CH3Cl in the presence of anhydrous AlCl3 to form

  1. chlorobenzene
  2. benzyl chloride
  3. xylene
  4. toluene.
AIPMT 2009
11

Nitrobenzene can be prepared from benzene by using a mixture of conc. HNO3 and conc. H2SO4. In the mixture, nitric acid acts as a/an

  1. acid
  2. base
  3. catalyst
  4. reducing agent
AIPMT 2009

All Hydrocarbons PYQs →

PDFDownload Hydrocarbons PYQs as PDF Free, with answer key and a QR code to every solution — print it or study offline⬇
All NEET Chemistry chapters
Physical ChemistrySome Basic Concepts of ChemistryStructure of AtomStates of MatterThermodynamicsEquilibriumRedox ReactionsSolid StateSolutionsElectrochemistryChemical KineticsSurface Chemistry
Inorganic ChemistryClassification of Elements and Periodicity in PropertiesChemical Bonding and Molecular StructureHydrogens-Block Elementsp-Block Elements (Group 13 & 14)Environmental ChemistryGeneral Principles of Isolation of Elementsp-Block Elements (Group 15–18)d- and f-Block ElementsCoordination Compounds
Organic ChemistryOrganic Chemistry – Some Basic Principles and TechniquesIsomerismHydrocarbonsHaloalkanes and HaloarenesAlcohols, Phenols and EthersAldehydes, Ketones and Carboxylic AcidsAminesBiomoleculesPolymersChemistry in Everyday LifePrinciples Related to Practical Chemistry